CAS 391218-14-7 appears in our catalog under these names: Rosuvastatin Impurity 176, 4R,6S)-6-(chloromethyl)-4-Hydroxytetrahydro-2H-Pyran-2-One. Offered by: Chemat Brand. Available pack sizes: on request.
(4R,6S)-6-(chloromethyl)-4-hydroxyoxan-2-one (CAS 391218-14-7) is a chemical compound with the molecular formula C6H9ClO3 and a molecular weight of 164.59 g/mol. IUPAC name: (4R,6S)-6-(chloromethyl)-4-hydroxyoxan-2-one. InChIKey: KLWVUDQIPZIXER-UHNVWZDZSA-N.
| Molecular formula | C6H9ClO3 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | (4R,6S)-6-(chloromethyl)-4-hydroxyoxan-2-one |
| InChIKey | KLWVUDQIPZIXER-UHNVWZDZSA-N |
| SMILES | C1[C@H](CC(=O)O[C@@H]1CCl)O |
Computed by PubChem (NCBI)