CAS 391218-16-9 is the registry number for Rosuvastatin Impurity 177. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-[(4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate (CAS 391218-16-9) is a chemical compound with the molecular formula C10H17ClO4 and a molecular weight of 236.69 g/mol. IUPAC name: methyl 2-[(4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate. InChIKey: XBKKDRGMLPLDEI-SFYZADRCSA-N.
| Molecular formula | C10H17ClO4 |
|---|---|
| Molecular weight | 236.69 g/mol |
| IUPAC name | methyl 2-[(4R,6S)-6-(chloromethyl)-2,2-dimethyl-1,3-dioxan-4-yl]acetate |
| InChIKey | XBKKDRGMLPLDEI-SFYZADRCSA-N |
| SMILES | CC1(O[C@H](C[C@H](O1)CCl)CC(=O)OC)C |
Computed by PubChem (NCBI)