Products 391220-15-8
CAS 391220-15-8 is the registry number for 2-Bromo-n-(4-methoxyphenyl)-3-methylbutanamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-bromo-N-(4-methoxyphenyl)-3-methylbutanamide (CAS 391220-15-8) is a chemical compound with the molecular formula C12H16BrNO2 and a molecular weight of 286.16 g/mol. IUPAC name: 2-bromo-N-(4-methoxyphenyl)-3-methylbutanamide. InChIKey: FHXCLDHAFSJZIZ-UHFFFAOYSA-N.
| Molecular formula | C12H16BrNO2 |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | 2-bromo-N-(4-methoxyphenyl)-3-methylbutanamide |
| InChIKey | FHXCLDHAFSJZIZ-UHFFFAOYSA-N |
| SMILES | CC(C)C(C(=O)NC1=CC=C(C=C1)OC)Br |
Computed by PubChem (NCBI)