Products 391221-30-0
CAS 391221-30-0 is the registry number for N-(5-Acetyl-4-phenylthiazol-2-yl)-2-methylbenzamide, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-methylbenzamide (CAS 391221-30-0) is a chemical compound with the molecular formula C19H16N2O2S and a molecular weight of 336.4 g/mol. IUPAC name: N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-methylbenzamide. InChIKey: HFALOGCIMNDJED-UHFFFAOYSA-N.
| Molecular formula | C19H16N2O2S |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | N-(5-acetyl-4-phenyl-1,3-thiazol-2-yl)-2-methylbenzamide |
| InChIKey | HFALOGCIMNDJED-UHFFFAOYSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=NC(=C(S2)C(=O)C)C3=CC=CC=C3 |
Computed by PubChem (NCBI)