CAS 391248-18-3 appears in our catalog under these names: 4-Julolidine boronic acid, 95%, 4-Julolidine boronic acid 98%, 9-Julolidine boronic acid. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylboronic acid (CAS 391248-18-3) is a chemical compound with the molecular formula C12H16BNO2 and a molecular weight of 217.07 g/mol. IUPAC name: 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylboronic acid. InChIKey: SYBWUXYYINOPAC-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO2 |
|---|---|
| Molecular weight | 217.07 g/mol |
| IUPAC name | 1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-ylboronic acid |
| InChIKey | SYBWUXYYINOPAC-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C3C(=C1)CCCN3CCC2)(O)O |
Computed by PubChem (NCBI)