CAS 3913-19-7 appears in our catalog under these names: 6–Bromo–2–chloro–4–methylquinoline, 6-Bromo-2-chloro-4-methylquinoline 95%, 6-Bromo-2-chloro-4-methylquinoline, 95%, 95%, 6-Bromo-2-chloro-4-methylquinoline, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
6-bromo-2-chloro-4-methylquinoline (CAS 3913-19-7) is a chemical compound with the molecular formula C10H7BrClN and a molecular weight of 256.52 g/mol. IUPAC name: 6-bromo-2-chloro-4-methylquinoline. InChIKey: NPDAQPXGOAYKAV-UHFFFAOYSA-N.
| Molecular formula | C10H7BrClN |
|---|---|
| Molecular weight | 256.52 g/mol |
| IUPAC name | 6-bromo-2-chloro-4-methylquinoline |
| InChIKey | NPDAQPXGOAYKAV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=C(C=C2)Br)Cl |
Computed by PubChem (NCBI)