Products 39162-75-9
CAS 39162-75-9 is the registry number for Asparaginate (calcium). Offered by: MedChemExpress. Available pack sizes: Get quote.
Calcium bis((2S)-2-amino-4-hydroxy-4-oxobutanoate) (CAS 39162-75-9) is a chemical compound with the molecular formula C8H12CaN2O8 and a molecular weight of 304.27 g/mol. IUPAC name: calcium bis((2S)-2-amino-4-hydroxy-4-oxobutanoate). InChIKey: VAFAEQCKZBKRLZ-CEOVSRFSSA-L.
| Molecular formula | C8H12CaN2O8 |
|---|---|
| Molecular weight | 304.27 g/mol |
| IUPAC name | calcium bis((2S)-2-amino-4-hydroxy-4-oxobutanoate) |
| InChIKey | VAFAEQCKZBKRLZ-CEOVSRFSSA-L |
| SMILES | C([C@@H](C(=O)[O-])N)C(=O)O.C([C@@H](C(=O)[O-])N)C(=O)O.[Ca+2] |
Computed by PubChem (NCBI)