Products 391624-46-7
CAS 391624-46-7 appears in our catalog under these names: Mono-Fmoc ethylene diamine hydrochloride, 98%, (9H–Fluoren–9–yl)methyl (2–aminoethyl)carbamate hydrochloride, Fmoc-EDA*HCl, Fmoc-1,2-diaminoethane·HCl, 95%, (9H-Fluoren-9-yl)methyl (2-aminoethyl)carbamate hydrochloride, 95%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, BLDpharm. Available pack sizes: 1g, 10g, 25g, 100g, 5g, 250mg, -, 50g.
9H-fluoren-9-ylmethyl N-(2-aminoethyl)carbamate;hydrochloride (CAS 391624-46-7) is a chemical compound with the molecular formula C17H19ClN2O2 and a molecular weight of 318.8 g/mol. IUPAC name: 9H-fluoren-9-ylmethyl N-(2-aminoethyl)carbamate;hydrochloride. InChIKey: UURYASDYOGIDRX-UHFFFAOYSA-N.
| Molecular formula | C17H19ClN2O2 |
|---|---|
| Molecular weight | 318.8 g/mol |
| IUPAC name | 9H-fluoren-9-ylmethyl N-(2-aminoethyl)carbamate;hydrochloride |
| InChIKey | UURYASDYOGIDRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCN.Cl |
Computed by PubChem (NCBI)
Synonyms:
MONO-FMOC ETHYLENE DIAMINE HYDROCHLORIDE, (9H-fluoren-9-yl)methyl (2-aminoethyl)carbamate hydrochloride, N-Fmoc-ethylenediamine hydrochloride, Fmoc-EDA.HCl, 9H-fluoren-9-ylmethyl N-(2-aminoethyl)carbamate;hydrochloride, n-fmoc-ethylenediamine, N-1-Fmoc-1,2-diaminoethane . HCl, Mono-fmoc ethylene diamine, HCl, Fmoc-EDA HCl, N-Fmoc-ethylenediamine HCl