CAS 391683-95-7 appears in our catalog under these names: dihydrogen dichlorobis(di–t–butylphosphinito–kp)palladate(2–), Bis[bis(1,1-dimethylethyl)phosphinous acid-κP]dichloropalladium. Offered by: GLPBio, Chemat. Available pack sizes: 25mg.
Bis(ditert-butylphosphinous acid);dichloropalladium (CAS 391683-95-7) is a chemical compound with the molecular formula C16H38Cl2O2P2Pd and a molecular weight of 501.7 g/mol. IUPAC name: bis(ditert-butylphosphinous acid);dichloropalladium. InChIKey: HHSVHPCHXCOYTG-UHFFFAOYSA-L.
| Molecular formula | C16H38Cl2O2P2Pd |
|---|---|
| Molecular weight | 501.7 g/mol |
| IUPAC name | bis(ditert-butylphosphinous acid);dichloropalladium |
| InChIKey | HHSVHPCHXCOYTG-UHFFFAOYSA-L |
| SMILES | CC(C)(C)P(C(C)(C)C)O.CC(C)(C)P(C(C)(C)C)O.Cl[Pd]Cl |
Computed by PubChem (NCBI)