CAS 391684-36-9 appears in our catalog under these names: T-Boc-n-amido-peg6-ch2co2h, 98%, Boc-NH-PEG6-CH2COOH, Boc–NH–PEG6–CH2COOH, Boc-NH-PEG6-CH2COOH 97%, t-Boc-N-amido-PEG6-CH2CO2H, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 5g, 1g, 50mg, 100mg, 10g, 25g, 100 mg.
2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid (CAS 391684-36-9) is a chemical compound with the molecular formula C19H37NO10 and a molecular weight of 439.5 g/mol. IUPAC name: 2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid. InChIKey: ZKCDWMFMVAYYED-UHFFFAOYSA-N.
| Molecular formula | C19H37NO10 |
|---|---|
| Molecular weight | 439.5 g/mol |
| IUPAC name | 2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]acetic acid |
| InChIKey | ZKCDWMFMVAYYED-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCC(=O)O |
Computed by PubChem (NCBI)