CAS 39192-49-9 is the registry number for 5-(chlorocarbonyl)-1,3-phenylene diacetate. Offered by: Chemat Brand. Available pack sizes: on request.
(3-acetyloxy-5-carbonochloridoylphenyl) acetate (CAS 39192-49-9) is a chemical compound with the molecular formula C11H9ClO5 and a molecular weight of 256.64 g/mol. IUPAC name: (3-acetyloxy-5-carbonochloridoylphenyl) acetate. InChIKey: QFBUFKRWGXGPEH-UHFFFAOYSA-N.
| Molecular formula | C11H9ClO5 |
|---|---|
| Molecular weight | 256.64 g/mol |
| IUPAC name | (3-acetyloxy-5-carbonochloridoylphenyl) acetate |
| InChIKey | QFBUFKRWGXGPEH-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)C(=O)Cl)OC(=O)C |
Computed by PubChem (NCBI)