CAS 392-86-9 appears in our catalog under these names: 2-Aminobenzene-1-sulfonyl fluoride, 95%, 2-aminobenzenesulphonyl fluoride, 98%. Offered by: Combi-blocks, Fluorochem, Ambeed. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
2-aminobenzenesulfonyl fluoride (CAS 392-86-9) is a chemical compound with the molecular formula C6H6FNO2S and a molecular weight of 175.18 g/mol. IUPAC name: 2-aminobenzenesulfonyl fluoride. InChIKey: OYJFEOGFHBNHRT-UHFFFAOYSA-N.
| Molecular formula | C6H6FNO2S |
|---|---|
| Molecular weight | 175.18 g/mol |
| IUPAC name | 2-aminobenzenesulfonyl fluoride |
| InChIKey | OYJFEOGFHBNHRT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N)S(=O)(=O)F |
Computed by PubChem (NCBI)