CAS 3920-38-5 appears in our catalog under these names: 1,3-Dimethyl-4-nitro-1H-pyrazole 95%, 1,3-Dimethyl-4-nitro-1H-pyrazole, 97%, 97%, 1,3-Dimethyl-4-nitro-1H-pyrazole, 95%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
1,3-dimethyl-4-nitropyrazole (CAS 3920-38-5) is a chemical compound with the molecular formula C5H7N3O2 and a molecular weight of 141.13 g/mol. IUPAC name: 1,3-dimethyl-4-nitropyrazole. InChIKey: AKFKERAVXIGUNB-UHFFFAOYSA-N.
| Molecular formula | C5H7N3O2 |
|---|---|
| Molecular weight | 141.13 g/mol |
| IUPAC name | 1,3-dimethyl-4-nitropyrazole |
| InChIKey | AKFKERAVXIGUNB-UHFFFAOYSA-N |
| SMILES | CC1=NN(C=C1[N+](=O)[O-])C |
Computed by PubChem (NCBI)