Products 392246-66-1
CAS 392246-66-1 is the registry number for 3,4-dimethyl-N-(4-(thiophen-2-yl)thiazol-2-yl)benzamide, ≥98%, ≥98%. Offered by: Chemat. Available pack sizes: 1mg, 5mg, 25mg, 100mg.
3,4-dimethyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide (CAS 392246-66-1) is a chemical compound with the molecular formula C16H14N2OS2 and a molecular weight of 314.4 g/mol. IUPAC name: 3,4-dimethyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide. InChIKey: OUIPGPMOOATOQE-UHFFFAOYSA-N.
| Molecular formula | C16H14N2OS2 |
|---|---|
| Molecular weight | 314.4 g/mol |
| IUPAC name | 3,4-dimethyl-N-(4-thiophen-2-yl-1,3-thiazol-2-yl)benzamide |
| InChIKey | OUIPGPMOOATOQE-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C(=O)NC2=NC(=CS2)C3=CC=CS3)C |
Computed by PubChem (NCBI)