CAS 39235-51-3 appears in our catalog under these names: N-(4-Amino-3-(trifluoromethyl)phenyl)-2-methylpropanamide, Flutamide Impurity 9, N-(4-Amino-3-(trifluoromethyl)phenyl)-2-methylpropanamide (FLU-6), >95% (HPLC), Flu-6, 98.44%. Offered by: Biosynth, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: 10mg, 5mg, 25mg, 50mg, 100mg, 200mg, 5 mg, 10 mg.
N-[4-amino-3-(trifluoromethyl)phenyl]-2-methylpropanamide (CAS 39235-51-3) is a chemical compound with the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. IUPAC name: N-[4-amino-3-(trifluoromethyl)phenyl]-2-methylpropanamide. InChIKey: SAKLWQRDMOSOGQ-UHFFFAOYSA-N.
| Molecular formula | C11H13F3N2O |
|---|---|
| Molecular weight | 246.23 g/mol |
| IUPAC name | N-[4-amino-3-(trifluoromethyl)phenyl]-2-methylpropanamide |
| InChIKey | SAKLWQRDMOSOGQ-UHFFFAOYSA-N |
| SMILES | CC(C)C(=O)NC1=CC(=C(C=C1)N)C(F)(F)F |
Computed by PubChem (NCBI)