Products 39238-09-0

CAS 39238-09-0 is the registry number for 5-(Chloromethyl)furan-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

5-(chloromethyl)furan-2-carboxylic acid (CAS 39238-09-0) is a chemical compound with the molecular formula C6H5ClO3 and a molecular weight of 160.55 g/mol. IUPAC name: 5-(chloromethyl)furan-2-carboxylic acid. InChIKey: XGJWKRJQEOSFCO-UHFFFAOYSA-N.

Identity
Molecular formulaC6H5ClO3
Molecular weight160.55 g/mol
IUPAC name5-(chloromethyl)furan-2-carboxylic acid
InChIKeyXGJWKRJQEOSFCO-UHFFFAOYSA-N
SMILESC1=C(OC(=C1)C(=O)O)CCl

Computed by PubChem (NCBI)