Products 39244-23-0

CAS 39244-23-0 is the registry number for Ethyl N-(4-hydroxycyclohexyl)carbamate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Ethyl N-(4-hydroxycyclohexyl)carbamate (CAS 39244-23-0) is a chemical compound with the molecular formula C9H17NO3 and a molecular weight of 187.24 g/mol. IUPAC name: ethyl N-(4-hydroxycyclohexyl)carbamate. InChIKey: LYNCTVPCPODSQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H17NO3
Molecular weight187.24 g/mol
IUPAC nameethyl N-(4-hydroxycyclohexyl)carbamate
InChIKeyLYNCTVPCPODSQZ-UHFFFAOYSA-N
SMILESCCOC(=O)NC1CCC(CC1)O

Computed by PubChem (NCBI)