CAS 39277-13-9 appears in our catalog under these names: Sodium hexabromoplatinate(IV) hexahydrate , Platinate(2-), hexabromo-, disodium, (OC-6-11)-, Pt 23.5%, Pt 23.5%. Offered by: Thermo Scientific (Alfa Aesar), Chemat. Available pack sizes: 1g, 5g, 100mg, 250mg.
Disodium;hexabromoplatinum(2-) (CAS 39277-13-9) is a chemical compound with the molecular formula Br6Na2Pt and a molecular weight of 720.5 g/mol. IUPAC name: disodium;hexabromoplatinum(2-). InChIKey: RFZKZIKSQSDBBI-UHFFFAOYSA-H.
| Molecular formula | Br6Na2Pt |
|---|---|
| Molecular weight | 720.5 g/mol |
| IUPAC name | disodium;hexabromoplatinum(2-) |
| InChIKey | RFZKZIKSQSDBBI-UHFFFAOYSA-H |
| SMILES | [Na+].[Na+].Br[Pt-2](Br)(Br)(Br)(Br)Br |
Computed by PubChem (NCBI)