Products 39277-41-3
CAS 39277-41-3 is the registry number for Viridicatumtoxin. Offered by: GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 1 mg.
Viridicatumtoxin is a tetracycline-like polyketide antibiotic that is produced by several species of Penicillium and Aspergillus. It has a role as an antimicrobial agent, an antineoplastic agent, a fungal metabolite and an EC 2.5.1.31 {ditrans,polycis-undecaprenyl-diphosphate synthase [(2E,6E)-farnesyl-diphosphate specific]} inhibitor. It is a tertiary alpha-hydroxy ketone, a primary carboxamide, a polyketide, a polyphenol, a tertiary alcohol, a spiro compound, an enol, an aromatic ether, a secondary alcohol, a cyclic ketone, an enone, an enamide, an organic polycyclic compound and an aromatic ketone.
Source: ChEBI
| Molecular formula | C30H31NO10 |
|---|---|
| Molecular weight | 565.6 g/mol |
| IUPAC name | (3'S,4'S,6S,9'S)-3',4',8',9',12',14'-hexahydroxy-16'-methoxy-1,5,5-trimethyl-6',10'-dioxospiro[cyclohexene-6,18'-pentacyclo[11.6.1.02,11.04,9.017,20]icosa-1(20),2(11),7,12,14,16-hexaene]-7'-carboxamide |
| InChIKey | FNSQKFOXORBCCC-WBWZXODPSA-N |
| SMILES | CC1=CCCC([C@@]12CC3=C4C2=C(C=C(C4=C(C5=C3[C@@H]([C@]6(CC(=O)C(=C([C@]6(C5=O)O)O)C(=O)N)O)O)O)O)OC)(C)C |
Computed by PubChem (NCBI)