Products 3929-89-3

CAS 3929-89-3 is the registry number for 2,3-Dihydroxy-4-methylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.

Structural formula: {0} (CAS {1})

2,3-dihydroxy-4-methylbenzoic acid (CAS 3929-89-3) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. IUPAC name: 2,3-dihydroxy-4-methylbenzoic acid. InChIKey: UWYHEGBHZPUZEE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8O4
Molecular weight168.15 g/mol
IUPAC name2,3-dihydroxy-4-methylbenzoic acid
InChIKeyUWYHEGBHZPUZEE-UHFFFAOYSA-N
SMILESCC1=C(C(=C(C=C1)C(=O)O)O)O

Computed by PubChem (NCBI)