CAS 3929-89-3 is the registry number for 2,3-Dihydroxy-4-methylbenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
2,3-dihydroxy-4-methylbenzoic acid (CAS 3929-89-3) is a chemical compound with the molecular formula C8H8O4 and a molecular weight of 168.15 g/mol. IUPAC name: 2,3-dihydroxy-4-methylbenzoic acid. InChIKey: UWYHEGBHZPUZEE-UHFFFAOYSA-N.
| Molecular formula | C8H8O4 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 2,3-dihydroxy-4-methylbenzoic acid |
| InChIKey | UWYHEGBHZPUZEE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)C(=O)O)O)O |
Computed by PubChem (NCBI)