CAS 393-06-6 appears in our catalog under these names: Enzalutamide Impurity 32, 4–Amino–2–(trifluoromethyl)benzoic acid, 4-Amino-2-(trifluoromethyl)benzoic acid, 97+% , 4-Amino-2-(trifluoromethyl)benzoic Acid, >98.0%(HPLC)(T), 4-Amino-2-(trifluoromethyl)benzoic acid 97%. Offered by: Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: on request, 100g, 25g, 500g, 1g, 5g, 10g.
4-amino-2-(trifluoromethyl)benzoic acid (CAS 393-06-6) is a chemical compound with the molecular formula C8H6F3NO2 and a molecular weight of 205.13 g/mol. IUPAC name: 4-amino-2-(trifluoromethyl)benzoic acid. InChIKey: AMVHEVZYTGHASE-UHFFFAOYSA-N.
| Molecular formula | C8H6F3NO2 |
|---|---|
| Molecular weight | 205.13 g/mol |
| IUPAC name | 4-amino-2-(trifluoromethyl)benzoic acid |
| InChIKey | AMVHEVZYTGHASE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)C(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)