CAS 393-32-8 is the registry number for 2,4-Bis(trifluoromethyl)thioanisole, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-methylsulfanyl-2,4-bis(trifluoromethyl)benzene (CAS 393-32-8) is a chemical compound with the molecular formula C9H6F6S and a molecular weight of 260.20 g/mol. IUPAC name: 1-methylsulfanyl-2,4-bis(trifluoromethyl)benzene. InChIKey: FLQSEAXHIMXVAI-UHFFFAOYSA-N.
| Molecular formula | C9H6F6S |
|---|---|
| Molecular weight | 260.20 g/mol |
| IUPAC name | 1-methylsulfanyl-2,4-bis(trifluoromethyl)benzene |
| InChIKey | FLQSEAXHIMXVAI-UHFFFAOYSA-N |
| SMILES | CSC1=C(C=C(C=C1)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)