CAS 393-76-0 is the registry number for 3,5-Dinitro-4-fluorobenzotrifluoride, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g, 5g.
2-fluoro-1,3-dinitro-5-(trifluoromethyl)benzene (CAS 393-76-0) is a chemical compound with the molecular formula C7H2F4N2O4 and a molecular weight of 254.10 g/mol. IUPAC name: 2-fluoro-1,3-dinitro-5-(trifluoromethyl)benzene. InChIKey: NVHWZCIXUHFQGS-UHFFFAOYSA-N.
| Molecular formula | C7H2F4N2O4 |
|---|---|
| Molecular weight | 254.10 g/mol |
| IUPAC name | 2-fluoro-1,3-dinitro-5-(trifluoromethyl)benzene |
| InChIKey | NVHWZCIXUHFQGS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1[N+](=O)[O-])F)[N+](=O)[O-])C(F)(F)F |
Computed by PubChem (NCBI)