CAS 3934-23-4 appears in our catalog under these names: 1H,1H-Perfluorooctyl methacrylate, 95%, 1H,1H-Perfluorooctyl methacrylate 95%, 1H,1H-PERFLUOROOCTYL METHACRYLATE, CONT&. Offered by: Combi-blocks, Ambeed, Sigma-Aldrich. Available pack sizes: 25g, 1g, 5g, 250mg, 10g.
2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl 2-methylprop-2-enoate (CAS 3934-23-4) is a chemical compound with the molecular formula C12H7F15O2 and a molecular weight of 468.16 g/mol. IUPAC name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl 2-methylprop-2-enoate. InChIKey: RUEKTOVLVIXOHT-UHFFFAOYSA-N.
| Molecular formula | C12H7F15O2 |
|---|---|
| Molecular weight | 468.16 g/mol |
| IUPAC name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctyl 2-methylprop-2-enoate |
| InChIKey | RUEKTOVLVIXOHT-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCC(C(C(C(C(C(C(F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F)(F)F |
Computed by PubChem (NCBI)