CAS 393509-23-4 appears in our catalog under these names: 2-(5-Bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid, 95%, 2–(5–Bromo–7–fluoro–1,2,3,4–tetrahydrocyclopenta(b)indol–3–yl)acetic acid, 2-(5-Bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid, 95% ,, 95% ,. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 100mg.
2-(5-bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid (CAS 393509-23-4) is a chemical compound with the molecular formula C13H11BrFNO2 and a molecular weight of 312.13 g/mol. IUPAC name: 2-(5-bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid. InChIKey: UFDLKQSJWWUVOQ-UHFFFAOYSA-N.
| Molecular formula | C13H11BrFNO2 |
|---|---|
| Molecular weight | 312.13 g/mol |
| IUPAC name | 2-(5-bromo-7-fluoro-1,2,3,4-tetrahydrocyclopenta[b]indol-3-yl)acetic acid |
| InChIKey | UFDLKQSJWWUVOQ-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C1CC(=O)O)NC3=C2C=C(C=C3Br)F |
Computed by PubChem (NCBI)