Products 393509-80-3

CAS 393509-80-3 is the registry number for Mesosulfuron Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-(methanesulfonamidomethyl)-2-sulfamoylbenzoate (CAS 393509-80-3) is a chemical compound with the molecular formula C10H14N2O6S2 and a molecular weight of 322.4 g/mol. IUPAC name: methyl 4-(methanesulfonamidomethyl)-2-sulfamoylbenzoate. InChIKey: PKRVNZBYNHOGDO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O6S2
Molecular weight322.4 g/mol
IUPAC namemethyl 4-(methanesulfonamidomethyl)-2-sulfamoylbenzoate
InChIKeyPKRVNZBYNHOGDO-UHFFFAOYSA-N
SMILESCOC(=O)C1=C(C=C(C=C1)CNS(=O)(=O)C)S(=O)(=O)N

Computed by PubChem (NCBI)