CAS 393509-80-3 is the registry number for Mesosulfuron Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 4-(methanesulfonamidomethyl)-2-sulfamoylbenzoate (CAS 393509-80-3) is a chemical compound with the molecular formula C10H14N2O6S2 and a molecular weight of 322.4 g/mol. IUPAC name: methyl 4-(methanesulfonamidomethyl)-2-sulfamoylbenzoate. InChIKey: PKRVNZBYNHOGDO-UHFFFAOYSA-N.
| Molecular formula | C10H14N2O6S2 |
|---|---|
| Molecular weight | 322.4 g/mol |
| IUPAC name | methyl 4-(methanesulfonamidomethyl)-2-sulfamoylbenzoate |
| InChIKey | PKRVNZBYNHOGDO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)CNS(=O)(=O)C)S(=O)(=O)N |
Computed by PubChem (NCBI)