CAS 393794-17-7 is the registry number for MRL-24, 99.58%. Offered by: MedChemExpress. Available pack sizes: 25 mg, 5 mg, 10 mg.
(2S)-2-[3-[[1-(4-methoxybenzoyl)-2-methyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid (CAS 393794-17-7) is a chemical compound with the molecular formula C28H24F3NO6 and a molecular weight of 527.5 g/mol. IUPAC name: (2S)-2-[3-[[1-(4-methoxybenzoyl)-2-methyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid. InChIKey: OFCWBJAYEIROGZ-KRWDZBQOSA-N.
| Molecular formula | C28H24F3NO6 |
|---|---|
| Molecular weight | 527.5 g/mol |
| IUPAC name | (2S)-2-[3-[[1-(4-methoxybenzoyl)-2-methyl-5-(trifluoromethoxy)indol-3-yl]methyl]phenoxy]propanoic acid |
| InChIKey | OFCWBJAYEIROGZ-KRWDZBQOSA-N |
| SMILES | CC1=C(C2=C(N1C(=O)C3=CC=C(C=C3)OC)C=CC(=C2)OC(F)(F)F)CC4=CC(=CC=C4)O[C@@H](C)C(=O)O |
Computed by PubChem (NCBI)