Products 393795-62-5
CAS 393795-62-5 is the registry number for 1-(Naphthalen-2-ylmethyl)-1H-indole, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 10g, 25g, 50g.
1-(naphthalen-2-ylmethyl)indole (CAS 393795-62-5) is a chemical compound with the molecular formula C19H15N and a molecular weight of 257.3 g/mol. IUPAC name: 1-(naphthalen-2-ylmethyl)indole. InChIKey: TVAMDAUPMMBOAJ-UHFFFAOYSA-N.
| Molecular formula | C19H15N |
|---|---|
| Molecular weight | 257.3 g/mol |
| IUPAC name | 1-(naphthalen-2-ylmethyl)indole |
| InChIKey | TVAMDAUPMMBOAJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C=C(C=CC2=C1)CN3C=CC4=CC=CC=C43 |
Computed by PubChem (NCBI)