CAS 3947-65-7 appears in our catalog under these names: Neomycin Sulfate EP Impurity A (Neamine), Neamine, >95% (HPLC), Neamine, Neamine 98+%, NEOMYCIN A. Offered by: Chemat Brand, TRC, GLPBio, Biosynth, Ambeed. Available pack sizes: on request, 100mg, 10mg, 25mg, 5mg, 2mg, 50mg, 250mg.
(2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol (CAS 3947-65-7) is a chemical compound with the molecular formula C12H26N4O6 and a molecular weight of 322.36 g/mol. IUPAC name: (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol. InChIKey: SYJXFKPQNSDJLI-HKEUSBCWSA-N.
| Molecular formula | C12H26N4O6 |
|---|---|
| Molecular weight | 322.36 g/mol |
| IUPAC name | (2R,3S,4R,5R,6R)-5-amino-2-(aminomethyl)-6-[(1R,2R,3S,4R,6S)-4,6-diamino-2,3-dihydroxycyclohexyl]oxyoxane-3,4-diol |
| InChIKey | SYJXFKPQNSDJLI-HKEUSBCWSA-N |
| SMILES | C1[C@H]([C@@H]([C@H]([C@@H]([C@H]1N)O[C@@H]2[C@@H]([C@H]([C@@H]([C@H](O2)CN)O)O)N)O)O)N |
Computed by PubChem (NCBI)