Products 394734-84-0
CAS 394734-84-0 appears in our catalog under these names: (1R,2S,5S)-6,6-Dimethyl-3-azabicyclo[3.1.0]hexane-2-methanol, 95%, (1R,2S,5S)-6,6-Dimethyl-3-azabicyclo(3.1.0)hexane-2-methanol. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 250mg, 100mg.
[(1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]methanol (CAS 394734-84-0) is a chemical compound with the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. IUPAC name: [(1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]methanol. InChIKey: XYHWQEDJUAJEAU-XVMARJQXSA-N.
| Molecular formula | C8H15NO |
|---|---|
| Molecular weight | 141.21 g/mol |
| IUPAC name | [(1R,2S,5S)-6,6-dimethyl-3-azabicyclo[3.1.0]hexan-2-yl]methanol |
| InChIKey | XYHWQEDJUAJEAU-XVMARJQXSA-N |
| SMILES | CC1([C@@H]2[C@H]1[C@H](NC2)CO)C |
Computed by PubChem (NCBI)