CAS 3948-46-7 is the registry number for Alpha,Alpha’-Paraxylyl Bismethanethiosulfonate. Offered by: TRC. Available pack sizes: 10mg, 25mg, 5mg.
1,4-bis(methylsulfonylsulfanylmethyl)benzene (CAS 3948-46-7) is a chemical compound with the molecular formula C10H14O4S4 and a molecular weight of 326.5 g/mol. IUPAC name: 1,4-bis(methylsulfonylsulfanylmethyl)benzene. InChIKey: FJJMUASPEZRNQI-UHFFFAOYSA-N.
| Molecular formula | C10H14O4S4 |
|---|---|
| Molecular weight | 326.5 g/mol |
| IUPAC name | 1,4-bis(methylsulfonylsulfanylmethyl)benzene |
| InChIKey | FJJMUASPEZRNQI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)SCC1=CC=C(C=C1)CSS(=O)(=O)C |
Computed by PubChem (NCBI)