CAS 39487-88-2 appears in our catalog under these names: 4-Chloro-3-nitro-7-(trifluoromethyl)quinoline, 95+%, 4-Chloro-3-nitro-7-(trifluoromethyl)quinoline. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
4-chloro-3-nitro-7-(trifluoromethyl)quinoline (CAS 39487-88-2) is a chemical compound with the molecular formula C10H4ClF3N2O2 and a molecular weight of 276.60 g/mol. IUPAC name: 4-chloro-3-nitro-7-(trifluoromethyl)quinoline. InChIKey: FBXDITKJZYEHCP-UHFFFAOYSA-N.
| Molecular formula | C10H4ClF3N2O2 |
|---|---|
| Molecular weight | 276.60 g/mol |
| IUPAC name | 4-chloro-3-nitro-7-(trifluoromethyl)quinoline |
| InChIKey | FBXDITKJZYEHCP-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=CN=C2C=C1C(F)(F)F)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)