Products 39492-89-2

CAS 39492-89-2 is the registry number for Perfluoro-3,5,7-trioxaoctanoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-2,2-difluoroacetic acid (CAS 39492-89-2) is a chemical compound with the molecular formula C5HF9O5 and a molecular weight of 312.04 g/mol. IUPAC name: 2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-2,2-difluoroacetic acid. InChIKey: SJKDXZGLKADOQD-UHFFFAOYSA-N.

Identity
Molecular formulaC5HF9O5
Molecular weight312.04 g/mol
IUPAC name2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-2,2-difluoroacetic acid
InChIKeySJKDXZGLKADOQD-UHFFFAOYSA-N
SMILESC(=O)(C(OC(OC(OC(F)(F)F)(F)F)(F)F)(F)F)O

Computed by PubChem (NCBI)