CAS 39492-89-2 is the registry number for Perfluoro-3,5,7-trioxaoctanoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-2,2-difluoroacetic acid (CAS 39492-89-2) is a chemical compound with the molecular formula C5HF9O5 and a molecular weight of 312.04 g/mol. IUPAC name: 2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-2,2-difluoroacetic acid. InChIKey: SJKDXZGLKADOQD-UHFFFAOYSA-N.
| Molecular formula | C5HF9O5 |
|---|---|
| Molecular weight | 312.04 g/mol |
| IUPAC name | 2-[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-2,2-difluoroacetic acid |
| InChIKey | SJKDXZGLKADOQD-UHFFFAOYSA-N |
| SMILES | C(=O)(C(OC(OC(OC(F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)