CAS 39492-90-5 is the registry number for Perfluoro-3,5,7,9-tetraoxadecanoic Acid. Offered by: Chemat Brand. Available pack sizes: on request.
2-[[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroacetic acid (CAS 39492-90-5) is a chemical compound with the molecular formula C6HF11O6 and a molecular weight of 378.05 g/mol. IUPAC name: 2-[[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroacetic acid. InChIKey: RVMKCACFKFAJPS-UHFFFAOYSA-N.
| Molecular formula | C6HF11O6 |
|---|---|
| Molecular weight | 378.05 g/mol |
| IUPAC name | 2-[[[difluoro(trifluoromethoxy)methoxy]-difluoromethoxy]-difluoromethoxy]-2,2-difluoroacetic acid |
| InChIKey | RVMKCACFKFAJPS-UHFFFAOYSA-N |
| SMILES | C(=O)(C(OC(OC(OC(OC(F)(F)F)(F)F)(F)F)(F)F)(F)F)O |
Computed by PubChem (NCBI)