CAS 39494-19-4 is the registry number for 2-Hydroxybenzaldehyde,palladium(2+), 97%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis(2-hydroxybenzaldehyde);palladium (CAS 39494-19-4) is a chemical compound with the molecular formula C14H12O4Pd and a molecular weight of 350.7 g/mol. IUPAC name: bis(2-hydroxybenzaldehyde);palladium. InChIKey: OAODMGHRSTVLBX-UHFFFAOYSA-N.
| Molecular formula | C14H12O4Pd |
|---|---|
| Molecular weight | 350.7 g/mol |
| IUPAC name | bis(2-hydroxybenzaldehyde);palladium |
| InChIKey | OAODMGHRSTVLBX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C=O)O.C1=CC=C(C(=C1)C=O)O.[Pd] |
Computed by PubChem (NCBI)