CAS 39513-21-8 appears in our catalog under these names: 2-Oxo-2,3-dihydro-1h-benzimidazole-5-sulfonic acid, 95%, 2-Oxo-2,3-dihydro-1H-benzo(d)imidazole-5-sulfonic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
2-oxo-1,3-dihydrobenzimidazole-5-sulfonic acid (CAS 39513-21-8) is a chemical compound with the molecular formula C7H6N2O4S and a molecular weight of 214.20 g/mol. IUPAC name: 2-oxo-1,3-dihydrobenzimidazole-5-sulfonic acid. InChIKey: IZLICCOPSQZBAZ-UHFFFAOYSA-N.
| Molecular formula | C7H6N2O4S |
|---|---|
| Molecular weight | 214.20 g/mol |
| IUPAC name | 2-oxo-1,3-dihydrobenzimidazole-5-sulfonic acid |
| InChIKey | IZLICCOPSQZBAZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1S(=O)(=O)O)NC(=O)N2 |
Computed by PubChem (NCBI)