CAS 39536-30-6 is the registry number for 2,2-Dimethyl-N-phenylpropanimidamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
2,2-dimethyl-N'-phenylpropanimidamide (CAS 39536-30-6) is a chemical compound with the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. IUPAC name: 2,2-dimethyl-N'-phenylpropanimidamide. InChIKey: NJEMGYZCSSHBCL-UHFFFAOYSA-N.
| Molecular formula | C11H16N2 |
|---|---|
| Molecular weight | 176.26 g/mol |
| IUPAC name | 2,2-dimethyl-N'-phenylpropanimidamide |
| InChIKey | NJEMGYZCSSHBCL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=NC1=CC=CC=C1)N |
Computed by PubChem (NCBI)