CAS 39541-20-3 appears in our catalog under these names: Azido 2-Acetamido-2-deoxy-3,4,6-tri-O-acetyl-Beta-D-galactopyranosyl, >95% (HPLC), Azido 2-acetamido-2-deoxy-3,4,6-tri-o-acetyl-β-D-galactopyranosyl, (2R,3R,4R,5R,6R)-5-Acetamido-2-(acetoxymethyl)-6-azidotetrahydro-2H-pyran-3,4-diyl diacetate, 95%, 95%. Offered by: TRC, Biosynth, Chemat. Available pack sizes: 100mg, 1g, 1000mg, 500mg, 250mg.
(5-acetamido-3,4-diacetyloxy-6-azidooxan-2-yl)methyl acetate (CAS 39541-20-3) is a chemical compound with the molecular formula C14H20N4O8 and a molecular weight of 372.33 g/mol. IUPAC name: (5-acetamido-3,4-diacetyloxy-6-azidooxan-2-yl)methyl acetate. InChIKey: RMCFMPMNMQZHSF-UHFFFAOYSA-N.
| Molecular formula | C14H20N4O8 |
|---|---|
| Molecular weight | 372.33 g/mol |
| IUPAC name | (5-acetamido-3,4-diacetyloxy-6-azidooxan-2-yl)methyl acetate |
| InChIKey | RMCFMPMNMQZHSF-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1C(C(C(OC1N=[N+]=[N-])COC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)