CAS 39569-21-6 is the registry number for Tetrabromo-o-chlorotoluene. Offered by: TRC. Available pack sizes: 250mg.
1,2,3,4-tetrabromo-5-chloro-6-methylbenzene (CAS 39569-21-6) is a chemical compound with the molecular formula C7H3Br4Cl and a molecular weight of 442.17 g/mol. IUPAC name: 1,2,3,4-tetrabromo-5-chloro-6-methylbenzene. InChIKey: WMXWTOJJASZOCL-UHFFFAOYSA-N.
| Molecular formula | C7H3Br4Cl |
|---|---|
| Molecular weight | 442.17 g/mol |
| IUPAC name | 1,2,3,4-tetrabromo-5-chloro-6-methylbenzene |
| InChIKey | WMXWTOJJASZOCL-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C(=C1Br)Br)Br)Br)Cl |
Computed by PubChem (NCBI)