CAS 39605-42-0 appears in our catalog under these names: Terbuthylazine Impurity 1, N-desethyl-N-(tert-butyl)-Terbuthylazine, >95% (HPLC), N2,N4-Di-tert-butyl-6-chloro-1,3,5-triazine-2,4-diamine 98%. Offered by: Chemat Brand, TRC, Ambeed. Available pack sizes: on request, 100mg, 1g, 500mg, 50mg, 250mg.
2-N,4-N-ditert-butyl-6-chloro-1,3,5-triazine-2,4-diamine (CAS 39605-42-0) is a chemical compound with the molecular formula C11H20ClN5 and a molecular weight of 257.76 g/mol. IUPAC name: 2-N,4-N-ditert-butyl-6-chloro-1,3,5-triazine-2,4-diamine. InChIKey: FOCLPSNTXOGURM-UHFFFAOYSA-N.
| Molecular formula | C11H20ClN5 |
|---|---|
| Molecular weight | 257.76 g/mol |
| IUPAC name | 2-N,4-N-ditert-butyl-6-chloro-1,3,5-triazine-2,4-diamine |
| InChIKey | FOCLPSNTXOGURM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)NC1=NC(=NC(=N1)Cl)NC(C)(C)C |
Computed by PubChem (NCBI)