CAS 396102-17-3 appears in our catalog under these names: (2,3-Dimethoxy-5-methylphenyl)boronic acid, 95%, (2,3-dimethoxy-5-methylphenyl)boronic acid. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(2,3-dimethoxy-5-methylphenyl)boronic acid (CAS 396102-17-3) is a chemical compound with the molecular formula C9H13BO4 and a molecular weight of 196.01 g/mol. IUPAC name: (2,3-dimethoxy-5-methylphenyl)boronic acid. InChIKey: MKFLYXCXQHLTTK-UHFFFAOYSA-N.
| Molecular formula | C9H13BO4 |
|---|---|
| Molecular weight | 196.01 g/mol |
| IUPAC name | (2,3-dimethoxy-5-methylphenyl)boronic acid |
| InChIKey | MKFLYXCXQHLTTK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)OC)C)(O)O |
Computed by PubChem (NCBI)