Products 39638-84-1
CAS 39638-84-1 is the registry number for 2-Methoxy-9-β-D-ribofuranosyl-9H-purine. Offered by: MedChemExpress. Available pack sizes: Get quote.
(2R,3S,4R,5R)-2-(hydroxymethyl)-5-(2-methoxypurin-9-yl)oxolane-3,4-diol (CAS 39638-84-1) is a chemical compound with the molecular formula C11H14N4O5 and a molecular weight of 282.25 g/mol. IUPAC name: (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(2-methoxypurin-9-yl)oxolane-3,4-diol. InChIKey: MYJDCGSSZDXIFP-FDDDBJFASA-N.
| Molecular formula | C11H14N4O5 |
|---|---|
| Molecular weight | 282.25 g/mol |
| IUPAC name | (2R,3S,4R,5R)-2-(hydroxymethyl)-5-(2-methoxypurin-9-yl)oxolane-3,4-diol |
| InChIKey | MYJDCGSSZDXIFP-FDDDBJFASA-N |
| SMILES | COC1=NC=C2C(=N1)N(C=N2)[C@H]3[C@@H]([C@@H]([C@H](O3)CO)O)O |
Computed by PubChem (NCBI)