Products 39647-01-3

CAS 39647-01-3 is the registry number for Methyl 2,2-dibromo-1-methylcyclopropane-1-carboxylate, 95%. Offered by: AmBeed. Available pack sizes: 5g.

Structural formula: {0} (CAS {1})

Methyl 2,2-dibromo-1-methylcyclopropane-1-carboxylate (CAS 39647-01-3) is a chemical compound with the molecular formula C6H8Br2O2 and a molecular weight of 271.93 g/mol. IUPAC name: methyl 2,2-dibromo-1-methylcyclopropane-1-carboxylate. InChIKey: IMIWMQAWODLGHY-UHFFFAOYSA-N.

Identity
Molecular formulaC6H8Br2O2
Molecular weight271.93 g/mol
IUPAC namemethyl 2,2-dibromo-1-methylcyclopropane-1-carboxylate
InChIKeyIMIWMQAWODLGHY-UHFFFAOYSA-N
SMILESCC1(CC1(Br)Br)C(=O)OC

Computed by PubChem (NCBI)