CAS 3966-30-1 appears in our catalog under these names: (R)-(-)-2-Hydroxy-2-phenylpropionic acid, 95%, (R)-(-)-2-Hydroxy-2-phenylpropionic acid, 98+% , (R)-2-hydroxy-2-phenylpropanoic acid, 95%, 95%, (R)-2-hydroxy-2-phenylpropanoic acid, 95%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 500mg.
(2R)-2-hydroxy-2-phenylpropanoic acid (CAS 3966-30-1) is a chemical compound with the molecular formula C9H10O3 and a molecular weight of 166.17 g/mol. IUPAC name: (2R)-2-hydroxy-2-phenylpropanoic acid. InChIKey: NWCHELUCVWSRRS-SECBINFHSA-N.
| Molecular formula | C9H10O3 |
|---|---|
| Molecular weight | 166.17 g/mol |
| IUPAC name | (2R)-2-hydroxy-2-phenylpropanoic acid |
| InChIKey | NWCHELUCVWSRRS-SECBINFHSA-N |
| SMILES | C[C@@](C1=CC=CC=C1)(C(=O)O)O |
Computed by PubChem (NCBI)