CAS 396716-50-0 appears in our catalog under these names: 1,2-Dibromopentafluoropropyl-2,2,3,3,3-pentafluoropropyl ether, 95%, 1,2-Dibromopentafluoropropyl-2,2,3,3,3-pentafluoropropyl ether, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 1g.
1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,3,3,3-pentafluoropropoxy)propane (CAS 396716-50-0) is a chemical compound with the molecular formula C6H2Br2F10O and a molecular weight of 439.87 g/mol. IUPAC name: 1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,3,3,3-pentafluoropropoxy)propane. InChIKey: XLBTXLUOMWOOEO-UHFFFAOYSA-N.
| Molecular formula | C6H2Br2F10O |
|---|---|
| Molecular weight | 439.87 g/mol |
| IUPAC name | 1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,3,3,3-pentafluoropropoxy)propane |
| InChIKey | XLBTXLUOMWOOEO-UHFFFAOYSA-N |
| SMILES | C(C(C(F)(F)F)(F)F)OC(C(C(F)(F)F)(F)Br)(F)Br |
Computed by PubChem (NCBI)