CAS 396716-52-2 appears in our catalog under these names: 1,2-Dibromopentafluoropropyl 2,2,2-trifluoroethyl ether, 95%, 1,2-Dibromopentafluoropropyl-2,2,2-trifluoroethyl ether, 97%. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 25g, 1g.
1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane (CAS 396716-52-2) is a chemical compound with the molecular formula C5H2Br2F8O and a molecular weight of 389.86 g/mol. IUPAC name: 1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane. InChIKey: VUXWJSADJYWRST-UHFFFAOYSA-N.
| Molecular formula | C5H2Br2F8O |
|---|---|
| Molecular weight | 389.86 g/mol |
| IUPAC name | 1,2-dibromo-1,2,3,3,3-pentafluoro-1-(2,2,2-trifluoroethoxy)propane |
| InChIKey | VUXWJSADJYWRST-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OC(C(C(F)(F)F)(F)Br)(F)Br |
Computed by PubChem (NCBI)