CAS 396726-03-7 appears in our catalog under these names: (E)-1-Hydroxy-2-Methyl-2-Butenyl 4-Pyrophosphate Lithium Salt, HMBPP lithium, 1-Hydroxy-2-methyl-2-buten-4-yl 4-diphosphate, (E)-1-HYDROXY-2-METHYL-2-BUTENYL 4-PYROP, Diphosphoric acid, mono[(2E)-4-hydroxy-3-methyl-2-butenyl] ester. Offered by: Chemat Brand, GLPBio, Biosynth, Sigma-Aldrich, Chemat. Available pack sizes: on request, 1mg, 2mg, 5mg, 5 mg, 1 mg.
[(4-hydroxy-3-methylbut-2-enoxy)-oxidophosphoryl] phosphate (CAS 396726-03-7) is a chemical compound with the molecular formula C5H9O8P2-3 and a molecular weight of 259.07 g/mol. IUPAC name: [(4-hydroxy-3-methylbut-2-enoxy)-oxidophosphoryl] phosphate. InChIKey: MDSIZRKJVDMQOQ-UHFFFAOYSA-K.
| Molecular formula | C5H9O8P2-3 |
|---|---|
| Molecular weight | 259.07 g/mol |
| IUPAC name | [(4-hydroxy-3-methylbut-2-enoxy)-oxidophosphoryl] phosphate |
| InChIKey | MDSIZRKJVDMQOQ-UHFFFAOYSA-K |
| SMILES | CC(=CCOP(=O)([O-])OP(=O)([O-])[O-])CO |
Computed by PubChem (NCBI)