CAS 39691-62-8 is the registry number for Nonylmagnesium bromide, 1M solution in diethyl ether, AcroSeal®. Offered by: Thermo Scientific (Acros). Available pack sizes: 100ML.
Magnesium;nonane;bromide (CAS 39691-62-8) is a chemical compound with the molecular formula C9H19BrMg and a molecular weight of 231.46 g/mol. IUPAC name: magnesium;nonane;bromide. InChIKey: LAEWDPMDQJHGJA-UHFFFAOYSA-M.
| Molecular formula | C9H19BrMg |
|---|---|
| Molecular weight | 231.46 g/mol |
| IUPAC name | magnesium;nonane;bromide |
| InChIKey | LAEWDPMDQJHGJA-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[CH2-].[Mg+2].[Br-] |
Computed by PubChem (NCBI)