CAS 397-50-2 is the registry number for 3-(Trifluoromethyl)-10H-phenothiazine. Offered by: TRC. Available pack sizes: 250mg.
3-(trifluoromethyl)-10H-phenothiazine (CAS 397-50-2) is a chemical compound with the molecular formula C13H8F3NS and a molecular weight of 267.27 g/mol. IUPAC name: 3-(trifluoromethyl)-10H-phenothiazine. InChIKey: PRMGVNCDUJBHQW-UHFFFAOYSA-N.
| Molecular formula | C13H8F3NS |
|---|---|
| Molecular weight | 267.27 g/mol |
| IUPAC name | 3-(trifluoromethyl)-10H-phenothiazine |
| InChIKey | PRMGVNCDUJBHQW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)NC3=C(S2)C=C(C=C3)C(F)(F)F |
Computed by PubChem (NCBI)