Products 3974-99-0

CAS 3974-99-0 is the registry number for isopropyl 2,2,2-trichloroacetate. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Propan-2-yl 2,2,2-trichloroacetate (CAS 3974-99-0) is a chemical compound with the molecular formula C5H7Cl3O2 and a molecular weight of 205.46 g/mol. IUPAC name: propan-2-yl 2,2,2-trichloroacetate. InChIKey: JYXIYFNAIFVCAN-UHFFFAOYSA-N.

Identity
Molecular formulaC5H7Cl3O2
Molecular weight205.46 g/mol
IUPAC namepropan-2-yl 2,2,2-trichloroacetate
InChIKeyJYXIYFNAIFVCAN-UHFFFAOYSA-N
SMILESCC(C)OC(=O)C(Cl)(Cl)Cl

Computed by PubChem (NCBI)